CAS 4120-76-7 is the registry number for 10-Bromo-9-phenanthrenol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
10-bromophenanthren-9-ol (CAS 4120-76-7) is a chemical compound with the molecular formula C14H9BrO and a molecular weight of 273.12 g/mol. IUPAC name: 10-bromophenanthren-9-ol. InChIKey: NWESITKKFMZEDY-UHFFFAOYSA-N.
| Molecular formula | C14H9BrO |
|---|---|
| Molecular weight | 273.12 g/mol |
| IUPAC name | 10-bromophenanthren-9-ol |
| InChIKey | NWESITKKFMZEDY-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=CC=CC=C3C(=C2O)Br |
Computed by PubChem (NCBI)