Products 4265-57-0

CAS 4265-57-0 is the registry number for 3,3'-(Methylenebis(sulfanediyl))dipropionic acid, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

3-(2-carboxyethylsulfanylmethylsulfanyl)propanoic acid (CAS 4265-57-0) is a chemical compound with the molecular formula C7H12O4S2 and a molecular weight of 224.3 g/mol. IUPAC name: 3-(2-carboxyethylsulfanylmethylsulfanyl)propanoic acid. InChIKey: KAHUZKHNNDOJNT-UHFFFAOYSA-N.

Identity
Molecular formulaC7H12O4S2
Molecular weight224.3 g/mol
IUPAC name3-(2-carboxyethylsulfanylmethylsulfanyl)propanoic acid
InChIKeyKAHUZKHNNDOJNT-UHFFFAOYSA-N
SMILESC(CSCSCCC(=O)O)C(=O)O

Computed by PubChem (NCBI)