CAS 434908-01-7 appears in our catalog under these names: Quinoline Impurity 17, 6-((Ethyl(4-fluorophenyl)amino)sulfonyl)-1,4-dihydro-4-oxo-3-quinolinecarboxylic Acid. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 250mg.
6-[ethyl-(4-fluorophenyl)sulfamoyl]-4-oxo-1H-quinoline-3-carboxylic acid (CAS 434908-01-7) is a chemical compound with the molecular formula C18H15FN2O5S and a molecular weight of 390.4 g/mol. IUPAC name: 6-[ethyl-(4-fluorophenyl)sulfamoyl]-4-oxo-1H-quinoline-3-carboxylic acid. InChIKey: JTSNUTXIEZTHOO-UHFFFAOYSA-N.
| Molecular formula | C18H15FN2O5S |
|---|---|
| Molecular weight | 390.4 g/mol |
| IUPAC name | 6-[ethyl-(4-fluorophenyl)sulfamoyl]-4-oxo-1H-quinoline-3-carboxylic acid |
| InChIKey | JTSNUTXIEZTHOO-UHFFFAOYSA-N |
| SMILES | CCN(C1=CC=C(C=C1)F)S(=O)(=O)C2=CC3=C(C=C2)NC=C(C3=O)C(=O)O |
Computed by PubChem (NCBI)