CAS 4356-77-8 is the registry number for ((2R,3R,4S,5R,6R)-6-Acetoxy-3,4,5-tris(benzyloxy)tetrahydro-2H-pyran-2-yl)methyl acetate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
[(2R,3R,4S,5R,6R)-6-acetyloxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl acetate (CAS 4356-77-8) is a chemical compound with the molecular formula C31H34O8 and a molecular weight of 534.6 g/mol. IUPAC name: [(2R,3R,4S,5R,6R)-6-acetyloxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl acetate. InChIKey: IFCAMEQHKHEHBS-SAEUYMBFSA-N.
| Molecular formula | C31H34O8 |
|---|---|
| Molecular weight | 534.6 g/mol |
| IUPAC name | [(2R,3R,4S,5R,6R)-6-acetyloxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl acetate |
| InChIKey | IFCAMEQHKHEHBS-SAEUYMBFSA-N |
| SMILES | CC(=O)OC[C@@H]1[C@H]([C@@H]([C@H]([C@H](O1)OC(=O)C)OCC2=CC=CC=C2)OCC3=CC=CC=C3)OCC4=CC=CC=C4 |
Computed by PubChem (NCBI)