Products 473795-32-3
CAS 473795-32-3 is the registry number for (1R,3R,4S)-rel-3-(BOC-amino)-1-azabicyclo[2.2.1]heptane, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
Tert-butyl N-[(3R,4S)-1-azabicyclo[2.2.1]heptan-3-yl]carbamate (CAS 473795-32-3) is a chemical compound with the molecular formula C11H20N2O2 and a molecular weight of 212.29 g/mol. IUPAC name: tert-butyl N-[(3R,4S)-1-azabicyclo[2.2.1]heptan-3-yl]carbamate. InChIKey: NIZTZRCJEKIRON-IUCAKERBSA-N.
| Molecular formula | C11H20N2O2 |
|---|---|
| Molecular weight | 212.29 g/mol |
| IUPAC name | tert-butyl N-[(3R,4S)-1-azabicyclo[2.2.1]heptan-3-yl]carbamate |
| InChIKey | NIZTZRCJEKIRON-IUCAKERBSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CN2CC[C@H]1C2 |
Computed by PubChem (NCBI)