Products 5107-10-8

CAS 5107-10-8 is the registry number for piperidine-2-carboxylic acid,hydrochloride, ≥98%, ≥98%. Offered by: Chemat. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

Piperidine-2-carboxylic acid;hydrochloride (CAS 5107-10-8) is a chemical compound with the molecular formula C6H12ClNO2 and a molecular weight of 165.62 g/mol. IUPAC name: piperidine-2-carboxylic acid;hydrochloride. InChIKey: AUGDEGXARBUSFU-UHFFFAOYSA-N.

Identity
Molecular formulaC6H12ClNO2
Molecular weight165.62 g/mol
IUPAC namepiperidine-2-carboxylic acid;hydrochloride
InChIKeyAUGDEGXARBUSFU-UHFFFAOYSA-N
SMILESC1CCNC(C1)C(=O)O.Cl

Computed by PubChem (NCBI)