Products 53370-47-1
CAS 53370-47-1 is the registry number for Hexamethylenetetramine camphorate. Offered by: Biosynth. Available pack sizes: 1000g.
1,3,5,7-tetrazatricyclo[3.3.1.13,7]decane;trans-(1R,3S)-1,2,2-trimethylcyclopentane-1,3-dicarboxylic acid (CAS 53370-47-1) is a chemical compound with the molecular formula C16H28N4O4 and a molecular weight of 340.42 g/mol. IUPAC name: 1,3,5,7-tetrazatricyclo[3.3.1.13,7]decane;trans-(1R,3S)-1,2,2-trimethylcyclopentane-1,3-dicarboxylic acid. InChIKey: MMWVNOOQBNSSLU-SXNOSCCBSA-N.
| Molecular formula | C16H28N4O4 |
|---|---|
| Molecular weight | 340.42 g/mol |
| IUPAC name | 1,3,5,7-tetrazatricyclo[3.3.1.13,7]decane;trans-(1R,3S)-1,2,2-trimethylcyclopentane-1,3-dicarboxylic acid |
| InChIKey | MMWVNOOQBNSSLU-SXNOSCCBSA-N |
| SMILES | C[C@]1(CC[C@@H](C1(C)C)C(=O)O)C(=O)O.C1N2CN3CN1CN(C2)C3 |
Computed by PubChem (NCBI)