CAS 53830-18-5 is the registry number for 9H-Carbazole, 9-ethyl-3,6-dinitro-, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 1g.
9-ethyl-3,6-dinitrocarbazole (CAS 53830-18-5) is a chemical compound with the molecular formula C14H11N3O4 and a molecular weight of 285.25 g/mol. IUPAC name: 9-ethyl-3,6-dinitrocarbazole. InChIKey: XMYZULFVNDPXLC-UHFFFAOYSA-N.
| Molecular formula | C14H11N3O4 |
|---|---|
| Molecular weight | 285.25 g/mol |
| IUPAC name | 9-ethyl-3,6-dinitrocarbazole |
| InChIKey | XMYZULFVNDPXLC-UHFFFAOYSA-N |
| SMILES | CCN1C2=C(C=C(C=C2)[N+](=O)[O-])C3=C1C=CC(=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)