Products 545401-99-8
CAS 545401-99-8 is the registry number for 2-Bromo-8-chlorodibenzo[b,d]thiophene, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-bromo-8-chlorodibenzothiophene (CAS 545401-99-8) is a chemical compound with the molecular formula C12H6BrClS and a molecular weight of 297.60 g/mol. IUPAC name: 2-bromo-8-chlorodibenzothiophene. InChIKey: DYPGQESWAPXXNR-UHFFFAOYSA-N.
| Molecular formula | C12H6BrClS |
|---|---|
| Molecular weight | 297.60 g/mol |
| IUPAC name | 2-bromo-8-chlorodibenzothiophene |
| InChIKey | DYPGQESWAPXXNR-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)C3=C(S2)C=CC(=C3)Br |
Computed by PubChem (NCBI)