Products 54732-46-6
CAS 54732-46-6 is the registry number for (S)-3-Amino-3-(4-hydroxyphenyl)propanoic acid, 98%. Offered by: Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
(3S)-3-amino-3-(4-hydroxyphenyl)propanoic acid (CAS 54732-46-6) is a chemical compound with the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. IUPAC name: (3S)-3-amino-3-(4-hydroxyphenyl)propanoic acid. InChIKey: JYPHNHPXFNEZBR-QMMMGPOBSA-N.
| Molecular formula | C9H11NO3 |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | (3S)-3-amino-3-(4-hydroxyphenyl)propanoic acid |
| InChIKey | JYPHNHPXFNEZBR-QMMMGPOBSA-N |
| SMILES | C1=CC(=CC=C1[C@H](CC(=O)O)N)O |
Computed by PubChem (NCBI)
Synonyms:
(S)-3-Amino-3-(4-hydroxyphenyl)propanoic acid, (S)-3-Amino-3-(4-hydroxyphenyl)propionic acid, (S)-b-Amino-4-hydroxybenzenepropanoic acid, (S)-beta-tyrosine, H-(S)-beta-Tyr-OH, (S)-3-Amino-3-(4-hydroxyphenyl)propanoicacid, L-3-Amino-3-(4-hydroxyphenyl)propanoic acid, L-3-amino-3- (4-hydroxyphenyl) propionic acid, Benzenepropanoic acid, beta-amino-4-hydroxy-, (betaS)-, (3S)-3-azanyl-3-(4-hydroxyphenyl)propanoic acid; Betatyrosine