Products 5496-31-1
CAS 5496-31-1 is the registry number for 2-(4-methylphenyl)-4,5-diphenyl-1H-imidazole, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g, 5g.
2-(4-methylphenyl)-4,5-diphenyl-1H-imidazole (CAS 5496-31-1) is a chemical compound with the molecular formula C22H18N2 and a molecular weight of 310.4 g/mol. IUPAC name: 2-(4-methylphenyl)-4,5-diphenyl-1H-imidazole. InChIKey: PMBIPEVLFRAOBR-UHFFFAOYSA-N.
| Molecular formula | C22H18N2 |
|---|---|
| Molecular weight | 310.4 g/mol |
| IUPAC name | 2-(4-methylphenyl)-4,5-diphenyl-1H-imidazole |
| InChIKey | PMBIPEVLFRAOBR-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=NC(=C(N2)C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)