CAS 55153-99-6 is the registry number for ethenyl-(4-methoxyphenyl)-dimethylsilane, 95%+(GC-MS),RG, 95%+(GC-MS),RG. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g.
Ethenyl-(4-methoxyphenyl)-dimethylsilane (CAS 55153-99-6) is a chemical compound with the molecular formula C11H16OSi and a molecular weight of 192.33 g/mol. IUPAC name: ethenyl-(4-methoxyphenyl)-dimethylsilane. InChIKey: XBJPKILXRGIENA-UHFFFAOYSA-N.
| Molecular formula | C11H16OSi |
|---|---|
| Molecular weight | 192.33 g/mol |
| IUPAC name | ethenyl-(4-methoxyphenyl)-dimethylsilane |
| InChIKey | XBJPKILXRGIENA-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)[Si](C)(C)C=C |
Computed by PubChem (NCBI)