Products 55320-60-0
CAS 55320-60-0 is the registry number for 2-Decanone-d5-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
1,1,1,3,3-pentadeuteriodecan-2-one (CAS 55320-60-0) is a chemical compound with the molecular formula C10H20O and a molecular weight of 161.30 g/mol. IUPAC name: 1,1,1,3,3-pentadeuteriodecan-2-one. InChIKey: ZAJNGDIORYACQU-OXSMHHRZSA-N.
| Molecular formula | C10H20O |
|---|---|
| Molecular weight | 161.30 g/mol |
| IUPAC name | 1,1,1,3,3-pentadeuteriodecan-2-one |
| InChIKey | ZAJNGDIORYACQU-OXSMHHRZSA-N |
| SMILES | [2H]C([2H])([2H])C(=O)C([2H])([2H])CCCCCCC |
Computed by PubChem (NCBI)