CAS 57784-06-2 is the registry number for Methyl 2,3,6-tri-o-benzoyl-alpha-d-glucopyranoside, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
[(2R,3R,4S,5R,6S)-4,5-dibenzoyloxy-3-hydroxy-6-methoxyoxan-2-yl]methyl benzoate (CAS 57784-06-2) is a chemical compound with the molecular formula C28H26O9 and a molecular weight of 506.5 g/mol. IUPAC name: [(2R,3R,4S,5R,6S)-4,5-dibenzoyloxy-3-hydroxy-6-methoxyoxan-2-yl]methyl benzoate. InChIKey: WXFFEILSURAFKL-NRUNVSGISA-N.
| Molecular formula | C28H26O9 |
|---|---|
| Molecular weight | 506.5 g/mol |
| IUPAC name | [(2R,3R,4S,5R,6S)-4,5-dibenzoyloxy-3-hydroxy-6-methoxyoxan-2-yl]methyl benzoate |
| InChIKey | WXFFEILSURAFKL-NRUNVSGISA-N |
| SMILES | CO[C@@H]1[C@@H]([C@H]([C@@H]([C@H](O1)COC(=O)C2=CC=CC=C2)O)OC(=O)C3=CC=CC=C3)OC(=O)C4=CC=CC=C4 |
Computed by PubChem (NCBI)