Products 57790-52-0
CAS 57790-52-0 appears in our catalog under these names: Prostaglandin E2 p–acetamidophenyl ester, Prostaglandin E2 p-acetamidophenyl ester. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 1 mg, 5 mg.
(4-acetamidophenyl) (Z)-7-[(1R,2R,3R)-3-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]hept-5-enoate (CAS 57790-52-0) is a chemical compound with the molecular formula C28H39NO6 and a molecular weight of 485.6 g/mol. IUPAC name: (4-acetamidophenyl) (Z)-7-[(1R,2R,3R)-3-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]hept-5-enoate. InChIKey: CNFZDRIMILJQQC-WLGUUIINSA-N.
| Molecular formula | C28H39NO6 |
|---|---|
| Molecular weight | 485.6 g/mol |
| IUPAC name | (4-acetamidophenyl) (Z)-7-[(1R,2R,3R)-3-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]hept-5-enoate |
| InChIKey | CNFZDRIMILJQQC-WLGUUIINSA-N |
| SMILES | CCCCC[C@@H](/C=C/[C@H]1[C@@H](CC(=O)[C@@H]1C/C=C\CCCC(=O)OC2=CC=C(C=C2)NC(=O)C)O)O |
Computed by PubChem (NCBI)