CAS 58-36-6 is the registry number for 10,10'-Oxybis(phenoxarsine), 99+%, 99+%. Offered by: Chemat. Available pack sizes: 5g, 25g.
10-phenoxarsinin-10-yloxyphenoxarsinine (CAS 58-36-6) is a chemical compound with the molecular formula C24H16As2O3 and a molecular weight of 502.2 g/mol. IUPAC name: 10-phenoxarsinin-10-yloxyphenoxarsinine. InChIKey: VCRZAKVGPJFABU-UHFFFAOYSA-N.
| Molecular formula | C24H16As2O3 |
|---|---|
| Molecular weight | 502.2 g/mol |
| IUPAC name | 10-phenoxarsinin-10-yloxyphenoxarsinine |
| InChIKey | VCRZAKVGPJFABU-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)OC3=CC=CC=C3[As]2O[As]4C5=CC=CC=C5OC6=CC=CC=C64 |
Computed by PubChem (NCBI)