Products 582289-87-0

CAS 582289-87-0 is the registry number for alpha,3,4-Tris((tetrahydro-2H-pyran-2-yl)oxy)benzeneacetic Acid Methyl Ester. Offered by: TRC. Available pack sizes: 50mg.

Structural formula: {0} (CAS {1})

Methyl 2-[3,4-bis(oxan-2-yloxy)phenyl]-2-(oxan-2-yloxy)acetate (CAS 582289-87-0) is a chemical compound with the molecular formula C24H34O8 and a molecular weight of 450.5 g/mol. IUPAC name: methyl 2-[3,4-bis(oxan-2-yloxy)phenyl]-2-(oxan-2-yloxy)acetate. InChIKey: SPDKGSZUEQRPAY-UHFFFAOYSA-N.

Identity
Molecular formulaC24H34O8
Molecular weight450.5 g/mol
IUPAC namemethyl 2-[3,4-bis(oxan-2-yloxy)phenyl]-2-(oxan-2-yloxy)acetate
InChIKeySPDKGSZUEQRPAY-UHFFFAOYSA-N
SMILESCOC(=O)C(C1=CC(=C(C=C1)OC2CCCCO2)OC3CCCCO3)OC4CCCCO4

Computed by PubChem (NCBI)