CAS 601523-21-1 is the registry number for 1,1,1,3,10,12,12,12-Octachlorododecane. Offered by: TRC. Available pack sizes: 2,5mg.
1,1,1,3,10,12,12,12-octachlorododecane (CAS 601523-21-1) is a chemical compound with the molecular formula C12H18Cl8 and a molecular weight of 445.9 g/mol. IUPAC name: 1,1,1,3,10,12,12,12-octachlorododecane. InChIKey: XMMPJGRRMUDPCM-UHFFFAOYSA-N.
| Molecular formula | C12H18Cl8 |
|---|---|
| Molecular weight | 445.9 g/mol |
| IUPAC name | 1,1,1,3,10,12,12,12-octachlorododecane |
| InChIKey | XMMPJGRRMUDPCM-UHFFFAOYSA-N |
| SMILES | C(CCCC(CC(Cl)(Cl)Cl)Cl)CCC(CC(Cl)(Cl)Cl)Cl |
Computed by PubChem (NCBI)