CAS 601523-23-3 is the registry number for 1,1,1,3,8,10,10,10-Octachlorodecane. Offered by: TRC. Available pack sizes: 10mg, 1mg, 5mg.
1,1,1,3,8,10,10,10-octachlorodecane (CAS 601523-23-3) is a chemical compound with the molecular formula C10H14Cl8 and a molecular weight of 417.8 g/mol. IUPAC name: 1,1,1,3,8,10,10,10-octachlorodecane. InChIKey: BOJKDARFGOJVKN-UHFFFAOYSA-N.
| Molecular formula | C10H14Cl8 |
|---|---|
| Molecular weight | 417.8 g/mol |
| IUPAC name | 1,1,1,3,8,10,10,10-octachlorodecane |
| InChIKey | BOJKDARFGOJVKN-UHFFFAOYSA-N |
| SMILES | C(CCC(CC(Cl)(Cl)Cl)Cl)CC(CC(Cl)(Cl)Cl)Cl |
Computed by PubChem (NCBI)