Products 60497-70-3
CAS 60497-70-3 is the registry number for (+)-Isojuvabiol. Offered by: TRC. Available pack sizes: 25mg.
Methyl (4R)-4-[(2R,4R)-4-hydroxy-6-methylheptan-2-yl]cyclohexene-1-carboxylate (CAS 60497-70-3) is a chemical compound with the molecular formula C16H28O3 and a molecular weight of 268.39 g/mol. IUPAC name: methyl (4R)-4-[(2R,4R)-4-hydroxy-6-methylheptan-2-yl]cyclohexene-1-carboxylate. InChIKey: KVQQCXYORPHUQU-VNHYZAJKSA-N.
| Molecular formula | C16H28O3 |
|---|---|
| Molecular weight | 268.39 g/mol |
| IUPAC name | methyl (4R)-4-[(2R,4R)-4-hydroxy-6-methylheptan-2-yl]cyclohexene-1-carboxylate |
| InChIKey | KVQQCXYORPHUQU-VNHYZAJKSA-N |
| SMILES | C[C@H](C[C@@H](CC(C)C)O)[C@@H]1CCC(=CC1)C(=O)OC |
Computed by PubChem (NCBI)