CAS 620167-11-5 is the registry number for VL-0395. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-[[3-[(5-carbamimidoyl-1H-indole-2-carbonyl)amino]benzoyl]amino]-3-phenylpropanoic acid (CAS 620167-11-5) is a chemical compound with the molecular formula C26H23N5O4 and a molecular weight of 469.5 g/mol. IUPAC name: 3-[[3-[(5-carbamimidoyl-1H-indole-2-carbonyl)amino]benzoyl]amino]-3-phenylpropanoic acid. InChIKey: RVWSCZNGPOUASU-UHFFFAOYSA-N.
| Molecular formula | C26H23N5O4 |
|---|---|
| Molecular weight | 469.5 g/mol |
| IUPAC name | 3-[[3-[(5-carbamimidoyl-1H-indole-2-carbonyl)amino]benzoyl]amino]-3-phenylpropanoic acid |
| InChIKey | RVWSCZNGPOUASU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(CC(=O)O)NC(=O)C2=CC(=CC=C2)NC(=O)C3=CC4=C(N3)C=CC(=C4)C(=N)N |
Computed by PubChem (NCBI)