CAS 62226-44-2 is the registry number for 2-(2-bromophenyl)bicyclo[2.2.1]heptane, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
(1R,2R,4S)-2-(2-bromophenyl)bicyclo[2.2.1]heptane (CAS 62226-44-2) is a chemical compound with the molecular formula C13H15Br and a molecular weight of 251.16 g/mol. IUPAC name: (1R,2R,4S)-2-(2-bromophenyl)bicyclo[2.2.1]heptane. InChIKey: AWRYSFURGRPJCP-HOSYDEDBSA-N.
| Molecular formula | C13H15Br |
|---|---|
| Molecular weight | 251.16 g/mol |
| IUPAC name | (1R,2R,4S)-2-(2-bromophenyl)bicyclo[2.2.1]heptane |
| InChIKey | AWRYSFURGRPJCP-HOSYDEDBSA-N |
| SMILES | C1C[C@@H]2C[C@H]1C[C@H]2C3=CC=CC=C3Br |
Computed by PubChem (NCBI)