Products 6300-50-1
CAS 6300-50-1 is the registry number for Direct red 254, 99.76%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 25 mg, 5 mg, 100 mg, 50 mg.
Disodium;7-amino-4-hydroxy-3-[[4-[(4-sulfonatophenyl)diazenyl]phenyl]diazenyl]naphthalene-2-sulfonate (CAS 6300-50-1) is a chemical compound with the molecular formula C22H15N5Na2O7S2 and a molecular weight of 571.5 g/mol. IUPAC name: disodium;7-amino-4-hydroxy-3-[[4-[(4-sulfonatophenyl)diazenyl]phenyl]diazenyl]naphthalene-2-sulfonate. InChIKey: DNDMQQPFVIIALP-UHFFFAOYSA-L.
| Molecular formula | C22H15N5Na2O7S2 |
|---|---|
| Molecular weight | 571.5 g/mol |
| IUPAC name | disodium;7-amino-4-hydroxy-3-[[4-[(4-sulfonatophenyl)diazenyl]phenyl]diazenyl]naphthalene-2-sulfonate |
| InChIKey | DNDMQQPFVIIALP-UHFFFAOYSA-L |
| SMILES | C1=CC(=CC=C1N=NC2=CC=C(C=C2)S(=O)(=O)[O-])N=NC3=C(C=C4C=C(C=CC4=C3O)N)S(=O)(=O)[O-].[Na+].[Na+] |
Computed by PubChem (NCBI)