CAS 639782-24-4 is the registry number for Pyridine, 2-phenyl-3-(trifluoromethyl)-, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
2-phenyl-3-(trifluoromethyl)pyridine (CAS 639782-24-4) is a chemical compound with the molecular formula C12H8F3N and a molecular weight of 223.19 g/mol. IUPAC name: 2-phenyl-3-(trifluoromethyl)pyridine. InChIKey: ZLRANBHTTCVNCE-UHFFFAOYSA-N.
| Molecular formula | C12H8F3N |
|---|---|
| Molecular weight | 223.19 g/mol |
| IUPAC name | 2-phenyl-3-(trifluoromethyl)pyridine |
| InChIKey | ZLRANBHTTCVNCE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C=CC=N2)C(F)(F)F |
Computed by PubChem (NCBI)