Products 66809-62-9
CAS 66809-62-9 is the registry number for 1-Benzyl-3-methylbenzimidazolium bromide, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-benzyl-3-methylbenzimidazol-3-ium bromide (CAS 66809-62-9) is a chemical compound with the molecular formula C15H15BrN2 and a molecular weight of 303.20 g/mol. IUPAC name: 1-benzyl-3-methylbenzimidazol-3-ium bromide. InChIKey: OFMYITHYPCVHGA-UHFFFAOYSA-M.
| Molecular formula | C15H15BrN2 |
|---|---|
| Molecular weight | 303.20 g/mol |
| IUPAC name | 1-benzyl-3-methylbenzimidazol-3-ium bromide |
| InChIKey | OFMYITHYPCVHGA-UHFFFAOYSA-M |
| SMILES | C[N+]1=CN(C2=CC=CC=C21)CC3=CC=CC=C3.[Br-] |
Computed by PubChem (NCBI)