CAS 668489-48-3 is the registry number for Bacitracin Impurity 2 . Offered by: Chemat Brand. Available pack sizes: on request.
2-[(1S)-1-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylpropyl]-1,3-thiazole-4-carboxylic acid (CAS 668489-48-3) is a chemical compound with the molecular formula C23H22N2O4S and a molecular weight of 422.5 g/mol. IUPAC name: 2-[(1S)-1-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylpropyl]-1,3-thiazole-4-carboxylic acid. InChIKey: ZJEFJTIFBRVRKY-FQEVSTJZSA-N.
| Molecular formula | C23H22N2O4S |
|---|---|
| Molecular weight | 422.5 g/mol |
| IUPAC name | 2-[(1S)-1-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylpropyl]-1,3-thiazole-4-carboxylic acid |
| InChIKey | ZJEFJTIFBRVRKY-FQEVSTJZSA-N |
| SMILES | CC(C)[C@@H](C1=NC(=CS1)C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)