Products 67919-37-3
CAS 67919-37-3 is the registry number for 1,2,3,4-Tetra-O-acetyl-D-glucuronic Acid, ≥95%. Offered by: Chemat. Available pack sizes: 250mg, 1g.
(2S,3S,4S,5R)-3,4,5,6-tetraacetyloxyoxane-2-carboxylic acid (CAS 67919-37-3) is a chemical compound with the molecular formula C14H18O11 and a molecular weight of 362.29 g/mol. IUPAC name: (2S,3S,4S,5R)-3,4,5,6-tetraacetyloxyoxane-2-carboxylic acid. InChIKey: FHWVABAZBHDMEY-HWRWQYJYSA-N.
| Molecular formula | C14H18O11 |
|---|---|
| Molecular weight | 362.29 g/mol |
| IUPAC name | (2S,3S,4S,5R)-3,4,5,6-tetraacetyloxyoxane-2-carboxylic acid |
| InChIKey | FHWVABAZBHDMEY-HWRWQYJYSA-N |
| SMILES | CC(=O)O[C@H]1[C@@H]([C@H](OC([C@@H]1OC(=O)C)OC(=O)C)C(=O)O)OC(=O)C |
Computed by PubChem (NCBI)