Products 68060-01-5
CAS 68060-01-5 is the registry number for Methyl heptanoate-d13. Offered by: MedChemExpress. Available pack sizes: Get quote.
Methyl 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecadeuterioheptanoate (CAS 68060-01-5) is a chemical compound with the molecular formula C8H16O2 and a molecular weight of 157.29 g/mol. IUPAC name: methyl 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecadeuterioheptanoate. InChIKey: XNCNNDVCAUWAIT-IFRPIJOISA-N.
| Molecular formula | C8H16O2 |
|---|---|
| Molecular weight | 157.29 g/mol |
| IUPAC name | methyl 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecadeuterioheptanoate |
| InChIKey | XNCNNDVCAUWAIT-IFRPIJOISA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C(=O)OC |
Computed by PubChem (NCBI)