CAS 68297-74-5 appears in our catalog under these names: (+)–Isopinocampheylborane TMEDA Complex, (+)-Isopinocampheylborane TMEDA Complex, >98.0%(N), (+)-Isopinocampheylborane TMEDA Complex. Offered by: GLPBio, TCI, Chemat. Available pack sizes: 1g, 5g.
CAS 68297-74-5 identifies a chemical compound with the molecular formula C26H50B2N2 and a molecular weight of 412.3 g/mol. InChIKey: YIPGSNPACSKQKJ-AUDPXGPISA-N.
| Molecular formula | C26H50B2N2 |
|---|---|
| Molecular weight | 412.3 g/mol |
| InChIKey | YIPGSNPACSKQKJ-AUDPXGPISA-N |
| SMILES | [B][C@@H]1C[C@@H]2C[C@H]([C@H]1C)C2(C)C.[B][C@@H]1C[C@@H]2C[C@H]([C@H]1C)C2(C)C.CN(C)CCN(C)C |
Computed by PubChem (NCBI)