Products 68451-89-8
CAS 68451-89-8 is the registry number for N'-(4-Chlorobenzoyloxy)-4-nitrobenzimidamide, 96%. Offered by: Combi-blocks. Available pack sizes: 25g, 500g, 1g, 100g, 5g.
[(Z)-[amino-(4-nitrophenyl)methylidene]amino] 4-chlorobenzoate (CAS 68451-89-8) is a chemical compound with the molecular formula C14H10ClN3O4 and a molecular weight of 319.70 g/mol. IUPAC name: [(Z)-[amino-(4-nitrophenyl)methylidene]amino] 4-chlorobenzoate. InChIKey: HNCUMRVHBCEURX-UHFFFAOYSA-N.
| Molecular formula | C14H10ClN3O4 |
|---|---|
| Molecular weight | 319.70 g/mol |
| IUPAC name | [(Z)-[amino-(4-nitrophenyl)methylidene]amino] 4-chlorobenzoate |
| InChIKey | HNCUMRVHBCEURX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1/C(=N/OC(=O)C2=CC=C(C=C2)Cl)/N)[N+](=O)[O-] |
Computed by PubChem (NCBI)