Products 691846-63-6
CAS 691846-63-6 appears in our catalog under these names: GMC 3–15, GMC 3-15. Offered by: GLPBio, Biosynth. Available pack sizes: 10mg, 50mg, 100mg.
4-[4-[[4-methoxy-3-(4-methylpiperazin-1-yl)phenyl]carbamoyl]phenyl]-3-methylbenzamide (CAS 691846-63-6) is a chemical compound with the molecular formula C27H30N4O3 and a molecular weight of 458.6 g/mol. IUPAC name: 4-[4-[[4-methoxy-3-(4-methylpiperazin-1-yl)phenyl]carbamoyl]phenyl]-3-methylbenzamide. InChIKey: VFXRXIHKXXMGNA-UHFFFAOYSA-N.
| Molecular formula | C27H30N4O3 |
|---|---|
| Molecular weight | 458.6 g/mol |
| IUPAC name | 4-[4-[[4-methoxy-3-(4-methylpiperazin-1-yl)phenyl]carbamoyl]phenyl]-3-methylbenzamide |
| InChIKey | VFXRXIHKXXMGNA-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C(=O)N)C2=CC=C(C=C2)C(=O)NC3=CC(=C(C=C3)OC)N4CCN(CC4)C |
Computed by PubChem (NCBI)