Products 700376-57-4
CAS 700376-57-4 is the registry number for Saxagliptin Impurity 36. Offered by: Chemat Brand. Available pack sizes: on request.
(1R,3S,5R)-2-azabicyclo[3.1.0]hexane-3-carboxamide (CAS 700376-57-4) is a chemical compound with the molecular formula C6H10N2O and a molecular weight of 126.16 g/mol. IUPAC name: (1R,3S,5R)-2-azabicyclo[3.1.0]hexane-3-carboxamide. InChIKey: MCEWPPMUTVLMJG-WDCZJNDASA-N.
| Molecular formula | C6H10N2O |
|---|---|
| Molecular weight | 126.16 g/mol |
| IUPAC name | (1R,3S,5R)-2-azabicyclo[3.1.0]hexane-3-carboxamide |
| InChIKey | MCEWPPMUTVLMJG-WDCZJNDASA-N |
| SMILES | C1[C@H]2[C@@H]1N[C@@H](C2)C(=O)N |
Computed by PubChem (NCBI)