CAS 70550-73-1 is the registry number for Calcitriol Impurity 28. Offered by: Chemat Brand. Available pack sizes: on request.
(1R,3aR,7aR)-1-[(2R)-6-hydroxy-6-methylheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one (CAS 70550-73-1) is a chemical compound with the molecular formula C18H32O2 and a molecular weight of 280.4 g/mol. IUPAC name: (1R,3aR,7aR)-1-[(2R)-6-hydroxy-6-methylheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one. InChIKey: GUXYSEJEKDEKNZ-ZXFNITATSA-N.
| Molecular formula | C18H32O2 |
|---|---|
| Molecular weight | 280.4 g/mol |
| IUPAC name | (1R,3aR,7aR)-1-[(2R)-6-hydroxy-6-methylheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one |
| InChIKey | GUXYSEJEKDEKNZ-ZXFNITATSA-N |
| SMILES | C[C@H](CCCC(C)(C)O)[C@H]1CC[C@@H]2[C@@]1(CCCC2=O)C |
Computed by PubChem (NCBI)