CAS 71172-44-6 is the registry number for Cyclopropyl(2,5-dimethylphenyl)methanone, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Cyclopropyl-(2,5-dimethylphenyl)methanone (CAS 71172-44-6) is a chemical compound with the molecular formula C12H14O and a molecular weight of 174.24 g/mol. IUPAC name: cyclopropyl-(2,5-dimethylphenyl)methanone. InChIKey: NRXRFPXXFISQQR-UHFFFAOYSA-N.
| Molecular formula | C12H14O |
|---|---|
| Molecular weight | 174.24 g/mol |
| IUPAC name | cyclopropyl-(2,5-dimethylphenyl)methanone |
| InChIKey | NRXRFPXXFISQQR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C)C(=O)C2CC2 |
Computed by PubChem (NCBI)