Products 71381-75-4

CAS 71381-75-4 is the registry number for 1-tert-Butoxycarbonylnipecotic acid, ≥97%, ≥97%. Offered by: Chemat. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-3-carboxylic acid (CAS 71381-75-4) is a chemical compound with the molecular formula C11H19NO4 and a molecular weight of 229.27 g/mol. IUPAC name: 1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-3-carboxylic acid. InChIKey: NXILIHONWRXHFA-UHFFFAOYSA-N.

Identity
Molecular formulaC11H19NO4
Molecular weight229.27 g/mol
IUPAC name1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-3-carboxylic acid
InChIKeyNXILIHONWRXHFA-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCCC(C1)C(=O)O

Computed by PubChem (NCBI)