Products 71609-08-0
CAS 71609-08-0 is the registry number for Capecitabine Impurity 11. Offered by: Chemat Brand. Available pack sizes: on request.
4-amino-1-[(2R,3S,4S,5R)-3,4-dihydroxy-5-methyloxolan-2-yl]-5-fluoropyrimidin-2-one (CAS 71609-08-0) is a chemical compound with the molecular formula C9H12FN3O4 and a molecular weight of 245.21 g/mol. IUPAC name: 4-amino-1-[(2R,3S,4S,5R)-3,4-dihydroxy-5-methyloxolan-2-yl]-5-fluoropyrimidin-2-one. InChIKey: YSNABXSEHNLERR-YQHTUYAKSA-N.
| Molecular formula | C9H12FN3O4 |
|---|---|
| Molecular weight | 245.21 g/mol |
| IUPAC name | 4-amino-1-[(2R,3S,4S,5R)-3,4-dihydroxy-5-methyloxolan-2-yl]-5-fluoropyrimidin-2-one |
| InChIKey | YSNABXSEHNLERR-YQHTUYAKSA-N |
| SMILES | C[C@@H]1[C@H]([C@@H]([C@@H](O1)N2C=C(C(=NC2=O)N)F)O)O |
Computed by PubChem (NCBI)