CAS 71668-81-0 is the registry number for (E,E,E)-2-Acetyl-5,9,13,17-tetramethyl-4,8,12,16-octadecatetraenoic Acid Ethyl Ester. Offered by: TRC. Available pack sizes: 10mg, 250mg, 50mg.
Ethyl (4E,8E,12E)-2-acetyl-5,9,13,17-tetramethyloctadeca-4,8,12,16-tetraenoate (CAS 71668-81-0) is a chemical compound with the molecular formula C26H42O3 and a molecular weight of 402.6 g/mol. IUPAC name: ethyl (4E,8E,12E)-2-acetyl-5,9,13,17-tetramethyloctadeca-4,8,12,16-tetraenoate. InChIKey: LKVFNVGYLKBFAA-INVBOZNNSA-N.
| Molecular formula | C26H42O3 |
|---|---|
| Molecular weight | 402.6 g/mol |
| IUPAC name | ethyl (4E,8E,12E)-2-acetyl-5,9,13,17-tetramethyloctadeca-4,8,12,16-tetraenoate |
| InChIKey | LKVFNVGYLKBFAA-INVBOZNNSA-N |
| SMILES | CCOC(=O)C(C/C=C(\C)/CC/C=C(\C)/CC/C=C(\C)/CCC=C(C)C)C(=O)C |
Computed by PubChem (NCBI)