CAS 71997-39-2 appears in our catalog under these names: Sodium (R)-2-((R)-1-(6-amino-9H-purin-9-yl)-2-oxoethoxy)-3-oxopropyl hydrogendiphosphate, 97%, ADENOSINE 5'-DIPHOSPHATE, PERIODATE, Adenosine 5'-diphosphate, periodate oxidized sodium salt. Offered by: Chemat Brand, Sigma-Aldrich, Chemat. Available pack sizes: on request, 25MG.
CAS 71997-39-2 identifies a chemical compound with the molecular formula C10H13N5NaO10P2 and a molecular weight of 448.18 g/mol. InChIKey: ULQAEEYTGARSBZ-UOERWJHTSA-N.
| Molecular formula | C10H13N5NaO10P2 |
|---|---|
| Molecular weight | 448.18 g/mol |
| InChIKey | ULQAEEYTGARSBZ-UOERWJHTSA-N |
| SMILES | C1=NC(=C2C(=N1)N(C=N2)[C@@H](C=O)O[C@H](COP(=O)(O)OP(=O)(O)O)C=O)N.[Na] |
Computed by PubChem (NCBI)