CAS 72962-60-8 is the registry number for 3-((1-Benzyl-1H-indazol-3-yl)oxy)-N,N-dimethylpropan-1-amine oxide maleate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(1-benzylindazol-3-yl)oxy-N,N-dimethylpropan-1-amine oxide;(E)-but-2-enedioic acid (CAS 72962-60-8) is a chemical compound with the molecular formula C23H27N3O6 and a molecular weight of 441.5 g/mol. IUPAC name: 3-(1-benzylindazol-3-yl)oxy-N,N-dimethylpropan-1-amine oxide;(E)-but-2-enedioic acid. InChIKey: QFAFNBZWRXPMSY-WLHGVMLRSA-N.
| Molecular formula | C23H27N3O6 |
|---|---|
| Molecular weight | 441.5 g/mol |
| IUPAC name | 3-(1-benzylindazol-3-yl)oxy-N,N-dimethylpropan-1-amine oxide;(E)-but-2-enedioic acid |
| InChIKey | QFAFNBZWRXPMSY-WLHGVMLRSA-N |
| SMILES | C[N+](C)(CCCOC1=NN(C2=CC=CC=C21)CC3=CC=CC=C3)[O-].C(=C/C(=O)O)\C(=O)O |
Computed by PubChem (NCBI)