CAS 733030-95-0 is the registry number for 5-Methyl-2-((methylsulfanyl)methyl)-4-oxo-3H,4H-thieno(2,3-d)pyrimidine-6-carboxylic Acid. Offered by: TRC. Available pack sizes: 250mg.
5-methyl-2-(methylsulfanylmethyl)-4-oxo-3H-thieno[2,3-d]pyrimidine-6-carboxylic acid (CAS 733030-95-0) is a chemical compound with the molecular formula C10H10N2O3S2 and a molecular weight of 270.3 g/mol. IUPAC name: 5-methyl-2-(methylsulfanylmethyl)-4-oxo-3H-thieno[2,3-d]pyrimidine-6-carboxylic acid. InChIKey: JQXYWLPJFYFWAN-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O3S2 |
|---|---|
| Molecular weight | 270.3 g/mol |
| IUPAC name | 5-methyl-2-(methylsulfanylmethyl)-4-oxo-3H-thieno[2,3-d]pyrimidine-6-carboxylic acid |
| InChIKey | JQXYWLPJFYFWAN-UHFFFAOYSA-N |
| SMILES | CC1=C(SC2=C1C(=O)NC(=N2)CSC)C(=O)O |
Computed by PubChem (NCBI)