CAS 739301-85-0 is the registry number for NSC45586. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-[[4-[(2,4-diamino-5-methylphenyl)diazenyl]phenyl]diazenyl]-2-hydroxybenzoic acid (CAS 739301-85-0) is a chemical compound with the molecular formula C20H18N6O3 and a molecular weight of 390.4 g/mol. IUPAC name: 5-[[4-[(2,4-diamino-5-methylphenyl)diazenyl]phenyl]diazenyl]-2-hydroxybenzoic acid. InChIKey: LNPJMIMLAFXLSJ-UHFFFAOYSA-N.
| Molecular formula | C20H18N6O3 |
|---|---|
| Molecular weight | 390.4 g/mol |
| IUPAC name | 5-[[4-[(2,4-diamino-5-methylphenyl)diazenyl]phenyl]diazenyl]-2-hydroxybenzoic acid |
| InChIKey | LNPJMIMLAFXLSJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1N)N)N=NC2=CC=C(C=C2)N=NC3=CC(=C(C=C3)O)C(=O)O |
Computed by PubChem (NCBI)