Products 74138-61-7
CAS 74138-61-7 appears in our catalog under these names: 3,4-Diamino-N-isopropylbenzimidamide hydrochloride, 98%, 3,4-Diamino-N-isopropylbenzimidamide hydrochloride, 98%, 98%. Offered by: Chemat Brand, Chemat, Fluorochem. Available pack sizes: on request, 100mg, 250mg, 1g.
3,4-diamino-N'-propan-2-ylbenzenecarboximidamide;hydrochloride (CAS 74138-61-7) is a chemical compound with the molecular formula C10H17ClN4 and a molecular weight of 228.72 g/mol. IUPAC name: 3,4-diamino-N'-propan-2-ylbenzenecarboximidamide;hydrochloride. InChIKey: JYMFICQZEZLDHY-UHFFFAOYSA-N.
| Molecular formula | C10H17ClN4 |
|---|---|
| Molecular weight | 228.72 g/mol |
| IUPAC name | 3,4-diamino-N'-propan-2-ylbenzenecarboximidamide;hydrochloride |
| InChIKey | JYMFICQZEZLDHY-UHFFFAOYSA-N |
| SMILES | CC(C)N=C(C1=CC(=C(C=C1)N)N)N.Cl |
Computed by PubChem (NCBI)