Products 741709-66-0
CAS 741709-66-0 appears in our catalog under these names: Dimethyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2,6-dicarboxylate, 96%, 2,6-Bis(methoxycarbonyl)pyridine-4-boronic acid, pinacol ester, 96%. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm. Available pack sizes: 250mg, 1g, 5g.
Dimethyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2,6-dicarboxylate (CAS 741709-66-0) is a chemical compound with the molecular formula C15H20BNO6 and a molecular weight of 321.14 g/mol. IUPAC name: dimethyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2,6-dicarboxylate. InChIKey: BQULHACFOJDBBI-UHFFFAOYSA-N.
| Molecular formula | C15H20BNO6 |
|---|---|
| Molecular weight | 321.14 g/mol |
| IUPAC name | dimethyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2,6-dicarboxylate |
| InChIKey | BQULHACFOJDBBI-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=NC(=C2)C(=O)OC)C(=O)OC |
Computed by PubChem (NCBI)