CAS 748133-81-5 is the registry number for 8H-thieno[2,3-b]indole-2-carboxamide, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg.
4H-thieno[2,3-b]indole-2-carboxamide (CAS 748133-81-5) is a chemical compound with the molecular formula C11H8N2OS and a molecular weight of 216.26 g/mol. IUPAC name: 4H-thieno[2,3-b]indole-2-carboxamide. InChIKey: LWYQSXZALURFMK-UHFFFAOYSA-N.
| Molecular formula | C11H8N2OS |
|---|---|
| Molecular weight | 216.26 g/mol |
| IUPAC name | 4H-thieno[2,3-b]indole-2-carboxamide |
| InChIKey | LWYQSXZALURFMK-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(N2)SC(=C3)C(=O)N |
Computed by PubChem (NCBI)