CAS 74867-73-5 is the registry number for Heptachlor. Offered by: Chemat Brand. Available pack sizes: on request.
(1R,2R,5R,6R,7S)-1,5,7,8,9,10,10-heptachlorotricyclo[5.2.1.02,6]deca-3,8-diene (CAS 74867-73-5) is a chemical compound with the molecular formula C10H5Cl7 and a molecular weight of 373.3 g/mol. IUPAC name: (1R,2R,5R,6R,7S)-1,5,7,8,9,10,10-heptachlorotricyclo[5.2.1.02,6]deca-3,8-diene. InChIKey: FRCCEHPWNOQAEU-WVANLWNPSA-N.
| Molecular formula | C10H5Cl7 |
|---|---|
| Molecular weight | 373.3 g/mol |
| IUPAC name | (1R,2R,5R,6R,7S)-1,5,7,8,9,10,10-heptachlorotricyclo[5.2.1.02,6]deca-3,8-diene |
| InChIKey | FRCCEHPWNOQAEU-WVANLWNPSA-N |
| SMILES | C1=C[C@H]([C@H]2[C@@H]1[C@]3(C(=C([C@@]2(C3(Cl)Cl)Cl)Cl)Cl)Cl)Cl |
Computed by PubChem (NCBI)