CAS 756531-27-8 is the registry number for Fmoc-D-Dap(2-Cl-Z)-OH. Offered by: Creative Peptides. Available pack sizes: 1g, 5g.
1-(2-chloro-2-phenylethyl)-N-[(3-fluorophenyl)methyl]pyrazolo[3,4-d]pyrimidin-4-amine (CAS 756531-27-8) is a chemical compound with the molecular formula C20H17ClFN5 and a molecular weight of 381.8 g/mol. IUPAC name: 1-(2-chloro-2-phenylethyl)-N-[(3-fluorophenyl)methyl]pyrazolo[3,4-d]pyrimidin-4-amine. InChIKey: IDZXNZQRVWDXGU-UHFFFAOYSA-N.
| Molecular formula | C20H17ClFN5 |
|---|---|
| Molecular weight | 381.8 g/mol |
| IUPAC name | 1-(2-chloro-2-phenylethyl)-N-[(3-fluorophenyl)methyl]pyrazolo[3,4-d]pyrimidin-4-amine |
| InChIKey | IDZXNZQRVWDXGU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(CN2C3=NC=NC(=C3C=N2)NCC4=CC(=CC=C4)F)Cl |
Computed by PubChem (NCBI)