CAS 757951-65-8 is the registry number for Fmoc-L-Pro(4-OcHx)-OH (2S,4R). Offered by: Iris Biotech. Available pack sizes: on request.
(2S,4S)-4-cyclohexyloxy-1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-2-carboxylic acid (CAS 757951-65-8) is a chemical compound with the molecular formula C26H29NO5 and a molecular weight of 435.5 g/mol. IUPAC name: (2S,4S)-4-cyclohexyloxy-1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-2-carboxylic acid. InChIKey: PWAHGESWYGBSFX-UUOWRZLLSA-N.
| Molecular formula | C26H29NO5 |
|---|---|
| Molecular weight | 435.5 g/mol |
| IUPAC name | (2S,4S)-4-cyclohexyloxy-1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-2-carboxylic acid |
| InChIKey | PWAHGESWYGBSFX-UUOWRZLLSA-N |
| SMILES | C1CCC(CC1)O[C@H]2C[C@H](N(C2)C(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35)C(=O)O |
Computed by PubChem (NCBI)