CAS 76121-99-8 appears in our catalog under these names: (6,6,7,7,8,8,8-Heptafluoro-2,2-dimethyl-3,5-octanedionato)silver, 98%, 98%, (6,6,7,7,8,8,8-Heptafluoro-2,2-dimethyl-3,5-octanedionato)silver, 98%. Offered by: Chemat, Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g.
Silver 6,6,7,7,8,8,8-heptafluoro-2,2-dimethyloctane-3,5-dione (CAS 76121-99-8) is a chemical compound with the molecular formula C10H10AgF7O2 and a molecular weight of 403.04 g/mol. IUPAC name: silver 6,6,7,7,8,8,8-heptafluoro-2,2-dimethyloctane-3,5-dione. InChIKey: SWDSDNGAFKTLCN-UHFFFAOYSA-N.
| Molecular formula | C10H10AgF7O2 |
|---|---|
| Molecular weight | 403.04 g/mol |
| IUPAC name | silver 6,6,7,7,8,8,8-heptafluoro-2,2-dimethyloctane-3,5-dione |
| InChIKey | SWDSDNGAFKTLCN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)[CH-]C(=O)C(C(C(F)(F)F)(F)F)(F)F.[Ag+] |
Computed by PubChem (NCBI)