CAS 76613-71-3 is the registry number for Pigment red 58:1, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg.
Barium(2+);5-[(3-carboxy-2-oxidonaphthalen-1-yl)diazenyl]-2-chlorobenzenesulfonate (CAS 76613-71-3) is a chemical compound with the molecular formula C17H9BaClN2O6S and a molecular weight of 542.1 g/mol. IUPAC name: barium(2+);5-[(3-carboxy-2-oxidonaphthalen-1-yl)diazenyl]-2-chlorobenzenesulfonate. InChIKey: NJAJGPWCPLVDBZ-UHFFFAOYSA-L.
| Molecular formula | C17H9BaClN2O6S |
|---|---|
| Molecular weight | 542.1 g/mol |
| IUPAC name | barium(2+);5-[(3-carboxy-2-oxidonaphthalen-1-yl)diazenyl]-2-chlorobenzenesulfonate |
| InChIKey | NJAJGPWCPLVDBZ-UHFFFAOYSA-L |
| SMILES | C1=CC=C2C(=C1)C=C(C(=C2N=NC3=CC(=C(C=C3)Cl)S(=O)(=O)[O-])[O-])C(=O)O.[Ba+2] |
Computed by PubChem (NCBI)