CAS 77111-29-6 is the registry number for NSC 295642. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 50mg, 5mg, 10 mg, 5 mg.
(Z)-benzylsulfanyl-[(Z)-1-pyridin-2-ylethylidenehydrazinylidene]-sulfidomethane;chlorocopper(1+) (CAS 77111-29-6) is a chemical compound with the molecular formula C15H14ClCuN3S2 and a molecular weight of 399.4 g/mol. IUPAC name: (Z)-benzylsulfanyl-[(Z)-1-pyridin-2-ylethylidenehydrazinylidene]-sulfidomethane;chlorocopper(1+). InChIKey: MGXCRQNCPJBYKM-GYMWKSPMSA-L.
| Molecular formula | C15H14ClCuN3S2 |
|---|---|
| Molecular weight | 399.4 g/mol |
| IUPAC name | (Z)-benzylsulfanyl-[(Z)-1-pyridin-2-ylethylidenehydrazinylidene]-sulfidomethane;chlorocopper(1+) |
| InChIKey | MGXCRQNCPJBYKM-GYMWKSPMSA-L |
| SMILES | C/C(=N/N=C(/[S-])\SCC1=CC=CC=C1)/C2=CC=CC=N2.Cl[Cu+] |
Computed by PubChem (NCBI)